Arachidonic acid omega-9 hydroperoxide

Molecular Formula: C20H32O4


InChI: InChI=1/C20H32O4/c1-2-3-4-5-10-13-16-19(24-23)17-14-11-8-6-7-9-12-15-18-20(21)22/h7-11,13-14,17,19,23H,2-6,12,15-16,18H2,1H3,(H,21,22)/b9-7-,11-8-,13-10-,17-14+/t19-/m0/s1/f/h21H

InChIKey: InChIKey=ZIOZYRSDNLNNNJ-CMWGCWKLDT
SMILES: CCCCC\C=C/C[[email protected]](OO)\C=C\C=C/C\C=C/CCCC(O)=O

Names:
    Arachidonic acid omega-9 hydroperoxide
    omega-9 Hpaa
    omega-9-Hydroperoxyarachidonic acid
    (5Z,8Z,10E,12S,14Z)-12-hydroperoxyicosa-5,8,10,14-tetraenoic acid
    (5Z,8Z,10E,14Z)-(12S)-12-Hydroperoxyeicosa-5,8,10,14-tetraenoate
    (5Z,8Z,10E,14Z)-(12S)-12-Hydroperoxyicosa-5,8,10,14-tetraenoate
    (5Z,8Z,10E,14Z)-(12S)-12-hydroperoxyicosa-5,8,10,14-tetraenoate
    (5Z,8Z,10E,14Z)-(12S)-12-Hydroperoxyicosa-5,8,10,14-tetraenoate
    (5Z,8Z,10E,14Z)-(12S)-12-Hydroperoxyicosa-5,8,10,14-tetraenoic acid
    12(S)-HPETE
    12-HpETE
    12-Hpete
    12-Hydroperoxyeicosatetraenoate
    12-Hydroperoxyeicosatetraenoic acid
    12-Hydroperoxyicosatetraenoate
    12-Hydroperoxyicosatetraenoic acid
    12-Oohete

Registries:
    PubChem CID 5280892
    ChEBI 15626
    Kegg C05965
    LIPID MAPS LMFA03060042
    PubChem ID 14826969
    PubChem ID 8249