8(S)-HPETE

Molecular Formula: C20H32O4


InChI: InChI=1/C20H32O4/c1-2-3-4-5-6-7-8-9-10-13-16-19(24-23)17-14-11-12-15-18-20(21)22/h6-7,9-11,13-14,16,19,23H,2-5,8,12,15,17-18H2,1H3,(H,21,22)/b7-6-,10-9-,14-11-,16-13+/t19-/m1/s1/f/h21H

InChIKey: InChIKey=QQUFCXFFOZDXLA-GYHALBABDW
SMILES: CCCCC\C=C/C/C=C\C=C\[[email protected]](C\C=C/CCCC(O)=O)OO

Names:
    CHEBI:34487
    (5Z,8S,9E,11Z,14Z)-8-hydroperoxyicosa-5,9,11,14-tetraenoic acid
    (5Z,9E,11Z,14Z)-(8S)-8-Hydroperoxyeicosa-5,9,11,14-tetraenoic acid
    (5Z,9E,11Z,14Z)-(8S)-8-Hydroperoxyicosa-5,9,11,14-tetraenoic acid
    8(S)-HPETE

Registries:
    PubChem CID 9548880
    ChEBI 34487
    Kegg C14823
    PubChem ID 14718382