15-Hydroperoxyeicosatetraenoic acid

Molecular Formula: C20H32O4


InChI: InChI=1/C20H32O4/c1-2-3-13-16-19(24-23)17-14-11-9-7-5-4-6-8-10-12-15-18-20(21)22/h4-5,8-11,14,17,19,23H,2-3,6-7,12-13,15-16,18H2,1H3,(H,21,22)/b5-4-,10-8-,11-9-,17-14+/t19-/m0/s1/f/h21H

InChIKey: InChIKey=BFWYTORDSFIVKP-NVIWDZNNDQ
SMILES: CCCCC[[email protected]](OO)\C=C\C=C/C\C=C/C\C=C/CCCC(O)=O

Names:
    (5Z,8Z,11Z,13E)-(15S)-15-Hydroperoxyicosa-5,8,11,13-tetraenoate
    (5Z,8Z,11Z,13E)-(15S)-15-hydroperoxyicosa-5,8,11,13-tetraenoate
    (5Z,8Z,11Z,13E)-(15S)-15-Hydroperoxyicosa-5,8,11,13-tetraenoate
    (5Z,8Z,11Z,13E)-(15S)-15-Hydroperoxyicosa-5,8,11,13-tetraenoic acid
    (5Z,8Z,11Z,13E,15S)-15-hydroperoxyicosa-5,8,11,13-tetraenoic acid
    15S-HpETE
    15(S)-HPETE
    15-Hydroperoxyeicosatetraenoate
    15-Hydroperoxyeicosatetraenoic acid
    15-Hydroperoxyicosatetraenoate
    15-Hydroperoxyicosatetraenoic acid

Registries:
    PubChem CID 5280893
    ChEBI 15628
    Kegg C05966
    LIPID MAPS LMFA03060014
    PubChem ID 15746930
    PubChem ID 8250