12(R)-HPETE

Molecular Formula: C20H32O4


InChI: InChI=1/C20H32O4/c1-2-3-4-5-10-13-16-19(24-23)17-14-11-8-6-7-9-12-15-18-20(21)22/h7-11,13-14,17,19,23H,2-6,12,15-16,18H2,1H3,(H,21,22)/b9-7-,11-8-,13-10-,17-14+/t19-/m1/s1/f/h21H

InChIKey: InChIKey=ZIOZYRSDNLNNNJ-KRUAZLFIDK
SMILES: CCCCC\C=C/C[[email protected]@H](OO)\C=C\C=C/C\C=C/CCCC(O)=O

Names:
    CHEBI:34145
    (5Z,8Z,10E,12R,14Z)-12-hydroperoxyicosa-5,8,10,14-tetraenoic acid
    (5Z,8Z,10E,14Z)-(12R)-12-Hydroperoxyeicosa-5,8,10,14-tetraenoic acid
    (5Z,8Z,10E,14Z)-(12R)-12-Hydroperoxyeicosa-5,8,10,14-tetraenoic
    (5Z,8Z,10E,14Z)-(12R)-12-Hydroperoxyeicosa-5,8,10,14-tetraenoic acid
    (5Z,8Z,10E,14Z)-(12R)-12-Hydroperoxyicosa-5,8,10,14-tetraenoic acid
    12(R)-HPETE

Registries:
    PubChem CID 9548885
    ChEBI 34145
    Kegg C14812
    PubChem ID 14718420