8R-HpETE

Molecular Formula: C20H32O4


InChI: InChI=1/C20H32O4/c1-2-3-4-5-6-7-8-9-10-13-16-19(24-23)17-14-11-12-15-18-20(21)22/h6-7,9-11,13-14,16,19,23H,2-5,8,12,15,17-18H2,1H3,(H,21,22)/b7-6-,10-9-,14-11-,16-13+/t19-/m0/s1/f/h21H

InChIKey: InChIKey=QQUFCXFFOZDXLA-AYVLCFHKDA
SMILES: CCCCC\C=C/C\C=C/C=C/[[email protected]@H](C\C=C/CCCC(O)=O)OO

Names:
    (5Z,8R,9E,11Z,14Z)-8-hydroperoxyicosa-5,9,11,14-tetraenoic acid
    (5Z,9E,11Z,14Z)-(8R)-8-hydroperoxyicosa-5,9,11,14-tetraenoate
    (5Z,9E,11Z,14Z)-(8R)-8-Hydroxyperoxyeicosa-5,9,11,14-tetraenoate
    (5Z,9E,11Z,14Z)-(8R)-8-Hydroxyperoxyicosa-5,9,11,14-tetraenoate
    8R-HpETE
    8(R)-HPETE

Registries:
    PubChem CID 5283170
    ChEBI 15629
    Kegg C04822
    LIPID MAPS LMFA03060037
    PubChem ID 11038803
    PubChem ID 7383