9(S)-HPETE

Molecular Formula: C20H32O4


InChI: InChI=1/C20H32O4/c1-2-3-4-5-6-7-8-10-13-16-19(24-23)17-14-11-9-12-15-18-20(21)22/h6-7,9-11,13-14,17,19,23H,2-5,8,12,15-16,18H2,1H3,(H,21,22)/b7-6-,11-9-,13-10-,17-14+/t19-/m0/s1/f/h21H

InChIKey: InChIKey=LIYCOTUUWOESJK-KFHGQLOKDW
SMILES: CCCCC\C=C/C\C=C/C[[email protected]](OO)\C=C\C=C/CCCC(O)=O

Names:
    CHEBI:34497
    (5Z,7E,11Z,14Z)-(9S)-9-Hydroperoxyeicosa-5,7,11,14-tetraenoic acid
    (5Z,7E,11Z,14Z)-(9S)-9-Hydroperoxyicosa-5,7,11,14-tetraenoic acid
    (5Z,7E,9S,11Z,14Z)-9-hydroperoxyicosa-5,7,11,14-tetraenoic acid
    9(S)-HPETE

Registries:
    PubChem CID 9548878
    ChEBI 34497
    Kegg C14821
    PubChem ID 14718379