11R-HETE

Molecular Formula: C20H32O3


InChI: InChI=1/C20H32O3/c1-2-3-4-5-7-10-13-16-19(21)17-14-11-8-6-9-12-15-18-20(22)23/h6-7,9-11,13-14,16,19,21H,2-5,8,12,15,17-18H2,1H3,(H,22,23)/b9-6-,10-7-,14-11-,16-13+/t19-/m0/s1/f/h22H

InChIKey: InChIKey=GCZRCCHPLVMMJE-QIZYVINMDY
SMILES: CCCCC/C=C\C=C\[[email protected]](O)C\C=C/C\C=C/CCCC(O)=O

CAS number 73347-43-0

Names:
    (5Z,8Z,11R,12E,14Z)-11-hydroxyicosa-5,8,12,14-tetraenoic acid
    (5Z,8Z,12E,14Z)-(11R)-Hydroxyeicosa-5,8,12,14-tetraenoic acid
    (5Z,8Z,12E,14Z)-(11R)-Hydroxyicosa-5,8,12,14-tetraenoic acid
    11R-HETE
    11(R)-HETE

Registries:
    PubChem CID 5283168
    Beilstein =5277419
    CAS 73347-43-0 (from NIST)
    ChEBI 34126
    Kegg C14780
    LIPID MAPS LMFA03060028
    PubChem ID 11038801