(5Z,8S,9E,11Z,14Z)-8-hydroxyicosa-5,9,11,14-tetraenoic acid

Molecular Formula: C20H32O3


InChI: InChI=1/C20H32O3/c1-2-3-4-5-6-7-8-9-10-13-16-19(21)17-14-11-12-15-18-20(22)23/h6-7,9-11,13-14,16,19,21H,2-5,8,12,15,17-18H2,1H3,(H,22,23)/b7-6-,10-9-,14-11-,16-13+/t19-/m1/s1/f/h22H

InChIKey: InChIKey=NLUNAYAEIJYXRB-CHARPQQFDP
SMILES: CCCCC\C=C/C\C=C/C=C/[[email protected]@H](O)C\C=C/CCCC(O)=O

CAS number 98462-03-4

Names:
    (5Z,8S,9E,11Z,14Z)-8-hydroxyicosa-5,9,11,14-tetraenoic acid
    (5Z,9E,11Z,14Z)-(8S)-8-Hydroxyeicosa-5,9,11,14-tetraenoic acid
    (5Z,9E,11Z,14Z)-(8S)-8-Hydroxyicosa-5,9,11,14-tetraenoic acid
    8S-HETE
    8(S)-HETE

Registries:
    PubChem CID 5283154
    Beilstein =4688095
    CAS 98462-03-4 (from NIST)
    ChEBI 34486
    Kegg C14776
    LIPID MAPS LMFA03060006
    PubChem ID 11038788