12(S)-Hydroxyeicosatetraenoic acid

Molecular Formula: C20H32O3


InChI: InChI=1/C20H32O3/c1-2-3-4-5-10-13-16-19(21)17-14-11-8-6-7-9-12-15-18-20(22)23/h7-11,13-14,17,19,21H,2-6,12,15-16,18H2,1H3,(H,22,23)/b9-7-,11-8-,13-10-,17-14+/t19-/m0/s1/f/h22H

InChIKey: InChIKey=ZNHVWPKMFKADKW-HVKREWNNDC
SMILES: CCCCC\C=C/C[[email protected]](O)\C=C\C=C/C\C=C/CCCC(O)=O

CAS number 54397-83-0

Names:
    (5Z,8Z,10E,12S,14Z)-12-hydroxyicosa-5,8,10,14-tetraenoic acid
    (5Z,8Z,10E,14Z)-(12S)-12-Hydroxyeicosa-5,8,10,14-tetraenoic acid
    (5Z,8Z,10E,14Z)-(12S)-12-Hydroxyicosa-5,8,10,14-tetraenoic acid
    12S-HETE
    12(S)-HETE
    12(S)-Hydroxyeicosatetraenoic acid

Registries:
    PubChem CID 5283155
    Beilstein =2656104
    CAS 54397-83-0 (from NIST)
    ChEBI 34146
    Kegg C14777
    LIPID MAPS LMFA03060007
    PubChem ID 10486782