11(R)-HPETE

Molecular Formula: C20H32O4


InChI: InChI=1/C20H32O4/c1-2-3-4-5-7-10-13-16-19(24-23)17-14-11-8-6-9-12-15-18-20(21)22/h6-7,9-11,13-14,16,19,23H,2-5,8,12,15,17-18H2,1H3,(H,21,22)/b9-6-,10-7-,14-11-,16-13+/t19-/m0/s1/f/h21H

InChIKey: InChIKey=PCGWZQXAGFGRTQ-NEGBRBAODG
SMILES: CCCCC/C=C\C=C\[[email protected]@H](C\C=C/C\C=C/CCCC(O)=O)OO

Names:
    CHEBI:34127
    (5Z,8Z,11R,12E,14Z)-11-hydroperoxyicosa-5,8,12,14-tetraenoic acid
    (5Z,8Z,12E,14Z)-(11R)-Hydroperoxyeicosa-5,8,12,14-tetraenoic acid
    (5Z,8Z,12E,14Z)-(11R)-Hydroperoxyicosa-5,8,12,14-tetraenoic acid
    11(R)-HPETE

Registries:
    PubChem CID 9548886
    ChEBI 34127
    Kegg C14820
    PubChem ID 14718422