
Mannitol - definition from

[a medication given to reduce brain swelling and elevated intracranial pressure. also used to temporarily disrupt the blood-brain barrier prior to some forms of chemotherapy.

Molecular Formula: C6H14O6

InChI: InChI=1/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4-,5-,6-/m1/s1

SMILES: OC[[email protected]@H](O)[[email protected]@H](O)[[email protected]](O)[[email protected]](O)CO


    PubChem CID 6251
    ChEBI 16899
    Kegg C00392
    PubChem ID 11528330
    PubChem ID 3682