L-Lyxitol

Molecular Formula: C5H12O5


InChI: InChI=1/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4-/m0/s1

InChIKey: InChIKey=HEBKCHPVOIAQTA-IMJSIDKUBK
SMILES: OC[[email protected]](O)C(O)[[email protected]@H](O)CO

Names:
    L-Arabinitol
    L-arabinitol
    L-Arabinitol
    L-arabinitol
    L-Arabinol
    L-arabinol
    L-Arabinol
    L-Arabitol
    L-arabitol
    L-Arabitol
    L-Lyxitol
    L-lyxitol
    L-Lyxitol
    (2S,4S)-pentane-1,2,3,4,5-pentol

Registries:
    PubChem CID 439255
    ChEBI 18403
    Kegg C00532
    PubChem ID 10298270
    PubChem ID 3814