
Molecular Formula: C5H12O5

InChI: InChI=1/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4+,5+

SMILES: [H][[email protected]](O)(CO)C([H])(O)[[email protected]]([H])(O)CO

CAS number 87-99-0


    PubChem CID 6912
    Beilstein =1720523
    CAS 87-99-0 (from NIST)
    ChEBI 17151
    chemPDB XYL
    Gmelin 82893
    Kegg C00379
    PubChem ID 11110027
    PubChem ID 3669