L-Sorbitol

Molecular Formula: C6H14O6


InChI: InChI=1/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4+,5-,6-/m0/s1

InChIKey: InChIKey=FBPFZTCFMRRESA-FSIIMWSLBL
SMILES: [H][[email protected]](O)(CO)[[email protected]]([H])(O)[[email protected]@]([H])(O)[[email protected]]([H])(O)CO

Names:
    D-Gulitol
    D-gulitol
    D-Gulitol
    L-Glucitol
    L-glucitol
    L-Glucitol
    L-glucitol
    L-Sorbitol
    L-sorbitol
    L-Sorbitol
    (2R,3S,4S,5S)-hexane-1,2,3,4,5,6-hexol

Registries:
    PubChem CID 82170
    ChEBI 28789
    Kegg C01722
    PubChem ID 10219218
    PubChem ID 4859