Medullin

Molecular Formula: C20H30O4


InChI: InChI=1/C20H30O4/c1-2-3-6-9-17(21)14-12-16-13-15-19(22)18(16)10-7-4-5-8-11-20(23)24/h4,7,12-18,21H,2-3,5-6,8-11H2,1H3,(H,23,24)/b7-4-,14-12+/t16-,17-,18+/m0/s1/f/h23H

InChIKey: InChIKey=MYHXHCUNDDAEOZ-VULITISFDD
SMILES: CCCCC[[email protected]](O)\C=C\[[email protected]]1C=CC(=O)[[email protected]@H]1C\C=C/CCCC(O)=O

Names:
    CHEBI:27820
    Medullin
    PGA2
    prostaglandin A2
    Prostaglandin A2
    prostaglandin A2
    (Z)-7-[(1R,2S)-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxo-1-cyclopent-3-enyl]hept-5-enoic acid
    (+)-Prostaglandin A(sup 2)
    (15S)-PGA2
    (15S)-Prostaglandin A2
    (5Z,13E,15S)-15-hydroxy-9-oxoprosta-5,10,13-trien-1-oic acid
    13345-50-1
    5,6-cis-PGA2

Registries:
    PubChem CID 5280880
    ChEBI 27820
    Kegg C05953
    LIPID MAPS LMFA03010035
    PubChem ID 14717647
    PubChem ID 8237