PGB2

Molecular Formula: C20H30O4


InChI: InChI=1/C20H30O4/c1-2-3-6-9-17(21)14-12-16-13-15-19(22)18(16)10-7-4-5-8-11-20(23)24/h4,7,12,14,17,21H,2-3,5-6,8-11,13,15H2,1H3,(H,23,24)/b7-4-,14-12+/t17-/m0/s1/f/h23H

InChIKey: InChIKey=PRFXRIUZNKLRHM-OEBAXYBJDK
SMILES: CCCCC[[email protected]](O)\C=C\C1=C(C\C=C/CCCC(O)=O)C(=O)CC1

Names:
    CHEBI:28099
    PGB2
    prostaglandin B2
    Prostaglandin B2
    prostaglandin B2
    (Z)-7-[2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxo-1-cyclopentenyl]hept-5-enoic acid
    (5Z,13E,15S)-15-hydroxy-9-oxoprosta-5,8(12),13-trien-1-oic acid
    13367-85-6

Registries:
    PubChem CID 5280881
    ChEBI 28099
    Kegg C05954
    LIPID MAPS LMFA03010018
    PubChem ID 14717681
    PubChem ID 8238