PGC2

Molecular Formula: C20H30O4


InChI: InChI=1/C20H30O4/c1-2-3-6-9-17(21)14-12-16-13-15-19(22)18(16)10-7-4-5-8-11-20(23)24/h4,7,12-14,17-18,21H,2-3,5-6,8-11,15H2,1H3,(H,23,24)/b7-4-,14-12+/t17-,18+/m0/s1/f/h23H

InChIKey: InChIKey=CMBOTAQMTNMTBD-KKVRAGGJDO
SMILES: CCCCC[[email protected]](O)\C=C\C1=CCC(=O)[[email protected]@H]1C\C=C/CCCC(O)=O

Names:
    CHEBI:27555
    PGC2
    Prostaglandin C2
    prostaglandin C2
    (Z)-7-[(1R)-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxo-1-cyclopent-2-enyl]hept-5-enoic acid

Registries:
    PubChem CID 5280882
    ChEBI 27555
    Kegg C05955
    LIPID MAPS LMFA03010133
    PubChem ID 14717655
    PubChem ID 8239