D-ido-Hexose

Molecular Formula: C6H12O6


InChI: InChI=1/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2/t3-,4-,5+,6+/m1/s1

InChIKey: InChIKey=GZCGUPFRVQAUEE-ZXXMMSQZBN
SMILES: [H][[email protected]@](O)(CO)[[email protected]]([H])(O)[[email protected]@]([H])(O)[[email protected]]([H])(O)C=O

Names:
    D-Idose
    D-ido-Hexose
    D-Ido
    D-Idose
    D-idose
    D-ido-Hexose
    (2S,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexanal

Registries:
    PubChem CID 111123
    ChEBI 28014
    Kegg C06466
    PubChem ID 10235483
    PubChem ID 8698