(3R,4R,5R)-3,4,5,6-tetrahydroxyhexanal

Molecular Formula: C6H12O5


InChI: InChI=1/C6H12O5/c7-2-1-4(9)6(11)5(10)3-8/h2,4-6,8-11H,1,3H2/t4-,5-,6-/m1/s1

InChIKey: InChIKey=VRYALKFFQXWPIH-HSUXUTPPBD
SMILES: [H]C([H])(C=O)[[email protected]@]([H])(O)[[email protected]@]([H])(O)[[email protected]]([H])(O)CO

CAS number 1949-89-9

Names:
    CHEBI:27411
    (3R,4R,5R)-3,4,5,6-tetrahydroxyhexanal
    1949-89-9
    2-Deoxy-D-galactose
    2-deoxy-D-galactose
    2-deoxy-D-lyxo-hexose

Registries:
    PubChem CID 102191
    CAS 1949-89-9 (from NIST)
    ChEBI 27411
    Kegg C02781
    PubChem ID 14717660
    PubChem ID 5732