table sugar

Sucrose - definition from Biology-Online.org

[Nonreducing disaccharide, _ D glucopyranosyl _ D fructofuranose. A complex carbohydrate found in many plants and used as a sweetening agent.A type of [[disaccharide that can be broken down by the [[enzyme [[sucrase.

Molecular Formula: C12H22O11


InChI: InChI=1/C12H22O11/c13-1-4-6(16)8(18)9(19)11(21-4)23-12(3-15)10(20)7(17)5(2-14)22-12/h4-11,13-20H,1-3H2/t4-,5-,6-,7-,8+,9-,10+,11-,12+/m1/s1

InChIKey: InChIKey=CZMRCDWAGMRECN-UGDNZRGBBE
SMILES: OC[[email protected]]1O[[email protected]](O[[email protected]]2(CO)O[[email protected]](CO)[[email protected]@H](O)[[email protected]@H]2O)[[email protected]](O)[[email protected]@H](O)[[email protected]@H]1O

CAS number 57-50-1

Names:
    Cane sugar
    Saccharose
    Sacharose
    suc
    Sucrose
    sucrose
    Sucrose
    SUCROSE
    sucrose
    table sugar
    β-D-Fruf-(2↔1)-α-D-Glcp
    (2R,3R,4S,5S,6R)-2-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol
    1-alpha-D-Glucopyranosyl-2-beta-D-fructofuranoside

Registries:
    PubChem CID 5988
    Beilstein =90825
    CAS 57-50-1 (from NIST)
    ChEBI 17992
    chemPDB SUC
    Gmelin 97695
    Kegg C00089
    PubChem ID 11532773
    PubChem ID 3389