alpha-cellobiose

Molecular Formula: C12H22O11


InChI: InChI=1/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5-,6+,7-,8-,9-,10-,11+,12+/m1/s1

InChIKey: InChIKey=GUBGYTABKSRVRQ-MFRLZQSSBC
SMILES: OC[[email protected]]1O[[email protected]@H](O[[email protected]]2[[email protected]](O)[[email protected]@H](O)[[email protected]@H](O)O[[email protected]@H]2CO)[[email protected]](O)[[email protected]@H](O)[[email protected]@H]1O

Names:
    alpha-Cellobiose
    alpha-cellobiose
    SDCCGMLS-0066676.P001
    (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[(2R,3S,4R,5R,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-oxane-3,4,5-triol
    1-beta-D-Glucopyranosyl-4-alpha-D-glucopyranose
    4-O-β-D-glucopyranosyl-α-D-glucopyranose

Registries:
    PubChem CID 441014
    ChEBI 28676
    Kegg C06421
    PubChem ID 11537697
    PubChem ID 8656