Hg [email protected]\IwMUURtBHP

Molecular Formula: C10H15N3O


InChI: InChI=1/C10H15N3O/c14-12-10-4-2-1-3-9(10)7-13-6-5-11-8-13/h5-6,8-9,14H,1-4,7H2/b12-10-

InChIKey: InChIKey=YAJDOQSLRRKPHY-BENRWUELBB
SMILES: C1CCC(=NO)C(C1)CN2C=CN=C2

Names:
    Hg [email protected]\IwMUURtBHP
    (NZ)-N-[2-(imidazol-1-ylmethyl)cyclohexylidene]hydroxylamine

Registries:
    PubChem CID 5830919
    PubChem ID 3274681