[email protected]

Molecular Formula: C7H12ClNO3S


InChI: InChI=1/C7H12ClNO3S/c1-13-3-2-5(7(11)12)9-6(10)4-8/h5H,2-4H2,1H3,(H,9,10)(H,11,12)/t5-/m0/s1/f/h9,11H

InChIKey: InChIKey=POPMMWHDENVQSV-RXAMRCBKDX
SMILES: CSCCC(C(=O)O)NC(=O)CCl

Names:
    [email protected]
    (2S)-2-[(2-chloroacetyl)amino]-4-methylsulfanyl-butanoic acid

Registries:
    PubChem CID 2795117
    PubChem ID 3250622