L-erythrose

Molecular Formula: C4H8O4


InChI: InChI=1/C4H8O4/c5-1-3(7)4(8)2-6/h1,3-4,6-8H,2H2/t3-,4+/m1/s1

InChIKey: InChIKey=YTBSYETUWUMLBZ-DMTCNVIQBE
SMILES: [H][[email protected]](O)(CO)[[email protected]]([H])(O)C=O

Names:
    L-erythrose
    (2S,3S)-2,3,4-trihydroxybutanal

Registries:
    PubChem CID 5460674
    ChEBI 21288
    PubChem ID 11688287