3-dehydro-L-gulonic acid


InChI: InChI=1/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-3,5,7-9,11H,1H2,(H,12,13)/t2-,3+,5-/m0/s1

InChIKey: InChIKey=WTAHRPBPWHCMHW-LWKDLAHABA
SMILES: OC[[email protected]](O)[[email protected]@H](O)C(=O)[[email protected]](O)C(O)=O

Names:
    3-Dehydro-L-gulonate
    3-dehydro-L-gulonate
    3-dehydro-L-gulonic acid

Registries:
    PubChem CID 439273
    ChEBI 16142
    Kegg C00618
    PubChem ID 3892