L-asparagine anion

Molecular Formula: C4H7N2O3-


InChI: InChI=1/C4H8N2O3/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H2,6,7)(H,8,9)/p-1/t2-/m0/s1/fC4H7N2O3/h6H2/q-1

InChIKey: InChIKey=DCXYFEDJOCDNAF-KHDJUYKWDZ
SMILES: N[[email protected]@H](CC(N)=O)C([O-])=O

Names:
    CHEBI:32650
    L-asparaginate
    L-asparagine anion
    (2S)-2,4-diamino-4-oxobutanoate
    (2S)-2-amino-3-carbamoyl-propanoate

Registries:
    PubChem CID 5460881
    Beilstein =6115348
    ChEBI 32650
    Gmelin 327371
    PubChem ID 8147586