chalcose

Molecular Formula: C7H14O4


InChI: InChI=1/C7H14O4/c1-5(9)3-7(11-2)6(10)4-8/h4-7,9-10H,3H2,1-2H3/t5-,6+,7+/m1/s1

InChIKey: InChIKey=NFQHDCDVJNGLLP-VQVTYTSYBJ
SMILES: [H]C([H])([[email protected]@]([H])(C)O)[[email protected]]([H])(OC)[[email protected]@]([H])(O)C=O

Names:
    chalcose
    CHEBI:30975
    (2R,3S,5R)-2,5-dihydroxy-3-methoxy-hexanal
    4,6-dideoxy-3-O-methyl-D-glucose
    4,6-dideoxy-3-O-methyl-D-xylo-hexose

Registries:
    PubChem CID 6857602
    ChEBI 30975
    PubChem ID 11533965