vitamin C

Ascorbic Acid A six carbon compound related to glucose. It is found naturally in citrus fruits and many vegetables. Ascorbic acid is an essential nutrient in human diets, and necessary to maintain connective tissue and bone. Its biologically active form, vitamin C, functions as a reducing agent and coenzyme in several metabolic pathways. Vitamin C is considered an antioxidant.

[1. A salt or ester of ascorbic acid.

Molecular Formula: C₆H₇O₆^-

InChI: InChI=1/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-8,10-11H,1H2/p-1/t2-,5+/m0/s1/fC6H7O6/h11h/q-1

InChIKey: InChIKey=TYQCGQRIZGCHNB-QLQCEUEZDI
SMILES: C(C(C1C(=O)C(=C(O1)[O-])O)O)O

Names:
    ascorbate
    CHEBI:13861
    L-ascorbate(1-)
    L-ascorbate
    L-Ascorbic acid, ion(1-)
    vitamin C
    (2R)-2-[(1S)-1,2-dihydroxyethyl]-4-hydroxy-5-oxo-2,5-dihydrofuran-3-olate
    (5R)-5-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-4-oxo-furan-2-olate
    299-36-5

Registries:
    PubChem CID 114765
    PubChem ID 8148163