abequose

Molecular Formula: C6H12O4


InChI: InChI=1/C6H12O4/c1-4(8)6(10)2-5(9)3-7/h3-6,8-10H,2H2,1H3/t4-,5-,6-/m1/s1

InChIKey: InChIKey=GNTQICZXQYZQNE-HSUXUTPPBP
SMILES: [H]C([H])([[email protected]@]([H])(O)C=O)[[email protected]@]([H])(O)[[email protected]@]([H])(C)O

Names:
    ABE
    Abequose
    Abe
    Abequose
    abequose
    CHEBI:27778
    (2R,4R,5R)-2,4,5-trihydroxyhexanal
    3,6-Deoxy-D-galactose
    3,6-deoxy-D-galactose
    3,6-Deoxy-D-xylo-hexose
    3,6-deoxy-D-xylo-hexose
    3,6-Dideoxy-D-xylo-hexose
    3,6-dideoxy-D-xylo-hexose
    3-Deoxy-D-fucose
    3-deoxy-D-fucose

Registries:
    PubChem CID 5460035
    ChEBI 27778
    Kegg C06471
    PubChem ID 8144457
    PubChem ID 8703