4-Methylene-L-glutamine


InChI: InChI=1/C6H10N2O3/c1-3(5(8)9)2-4(7)6(10)11/h4H,1-2,7H2,(H2,8,9)(H,10,11)/t4-/m0/s1

InChIKey: InChIKey=CEVQXWMPODOBRM-BYPYZUCNBU
SMILES: N[[email protected]@H](CC(=C)C(N)=O)C(O)=O

Names:
    4-Methylene-L-glutamine
    4-methylene-L-glutamine
    4-Methylene-L-glutamine
    4-methylene-L-glutamine

Registries:
    PubChem CID 439401
    ChEBI 16747
    Kegg C01109
    PubChem ID 4341