bacillosamine

Molecular Formula: C6H14N2O3


InChI: InChI=1/C6H14N2O3/c1-3(10)5(8)6(11)4(7)2-9/h2-6,10-11H,7-8H2,1H3/t3-,4+,5-,6-/m1/s1

InChIKey: InChIKey=UOKKJQVOZSYEJM-JGWLITMVBO
SMILES: [H][[email protected]](C)(O)[[email protected]@]([H])(N)[[email protected]]([H])(O)[[email protected]@]([H])(N)C=O

Names:
    bacillosamine
    (2R,3S,4R,5R)-2,4-diamino-3,5-dihydroxy-hexanal
    2,6-Diamino-2,4,6-trideoxy-D-xylo-hexopyranoside
    4-Deoxyneosamine C
    7013-45-8

Registries:
    PubChem CID 192835
    ChEBI 32538
    PubChem ID 770205