CHEBI:15630

Molecular Formula: C20H34O5


InChI: InChI=1/C20H34O5/c1-2-3-4-5-6-10-13-18(22)19(23)16-15-17(21)12-9-7-8-11-14-20(24)25/h6-7,9-10,15-19,21-23H,2-5,8,11-14H2,1H3,(H,24,25)/b9-7-,10-6-,16-15+/t17?,18-,19?/m1/s1/f/h24H

InChIKey: InChIKey=WPLPEZUSILBTGP-YGQFNXSWDJ
SMILES: CCCCC\C=C/C[[email protected]@H](O)C(O)\C=C\C(O)C\C=C/CCCC(O)=O

Names:
    CHEBI:15630
    (5Z,9E,12R,14Z)-8,11,12-trihydroxyicosa-5,9,14-trienoic acid
    (5Z,9E,12S,14Z)-8,11,12-trihydroxyicosa-5,9,14-trienoic acid
    (5Z,9E,14Z)-(8xi,11xi,12S)-8,11,12-Trihydroxyicosa-5,9,14-trienoate
    (5Z,9E,14Z)-(8xi,11xi,12S)-8,11,12-Trihydroxyicosa-5,9,14-trienoic acid
    (5Z,9E,14Z)-(8xi,11xi,12S)-8,11,12-Trihydroxyicosa-5,9,14-trienoic
    (5Z,9E,14Z)-(8xi,11xi,12S)-8,11,12-Trihydroxyicosa-5,9,14-trienoic acid
    (5Z,9E,14Z)-(8ξ,11ξ,12S)-8,11,12-trihydroxyicosa-5,9,14-trienoate

Registries:
    PubChem CID 9548609
    ChEBI 15630
    Kegg C04843
    PubChem ID 7400
    PubChem ID 8145793