(2R,5S)-5-methyl-2-propan-2-yl-cyclohexan-1-one

Molecular Formula: C10H18O


InChI: InChI=1/C10H18O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-9H,4-6H2,1-3H3/t8-,9+/m0/s1

InChIKey: InChIKey=NFLGAXVYCFJBMK-DTWKUNHWBG
SMILES: CC(C)[[email protected]]1CC[[email protected]](C)CC1=O

CAS number 3391-87-5

Names:
    (+)-Menthone
    (+)-menthone
    (1S,4R)-p-menthan-3-one
    (2R,5S)-2-isopropyl-5-methylcyclohexanone
    (2R,5S)-5-methyl-2-propan-2-yl-cyclohexan-1-one

Registries:
    PubChem CID 443159
    Beilstein =2041367
    Beilstein =5245020
    CAS 3391-87-5 (from NIST)
    ChEBI 31
    Kegg C11390
    PubChem ID 10299219
    PubChem ID 13564