inulobiose

Molecular Formula: C11H20O10


InChI: InChI=1/C11H20O10/c12-1-4(14)7(16)8(17)5(15)3-20-11-10(19)9(18)6(2-13)21-11/h4,6-14,16-19H,1-3H2/t4-,6-,7-,8-,9-,10+,11-/m1/s1

InChIKey: InChIKey=KPMCTJNYSBBNPK-CKWVLFJBBP
SMILES: [H][[email protected]@](O)(CO)[[email protected]@]([H])(O)[[email protected]]([H])(O)C(=O)CO[[email protected]@H]1O[[email protected]](CO)[[email protected]@H](O)[[email protected]@H]1O

Names:
    beta-D-fructofuranosyl-(2->1)-D-fructose
    CHEBI:16751
    D-fructosyl-2,1-alpha-D-fructose
    D-fructosyl-2,1-α-D-fructose
    Inulobiose
    inulobiose
    Inulobiose
    inulobiose
    (3S,4R,5R)-1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-3,4,5,6-tetrahydroxy-hexan-2-one
    1-O-beta-D-fructofuranosyl-D-fructose
    1-O-beta-D-Fructo-furanosyl-D-fructose

Registries:
    PubChem CID 5460149
    ChEBI 16751
    Kegg C01711
    PubChem ID 4849
    PubChem ID 8144917