(15S)-15-Hydroxy-5,8,11-cis-13-trans-eicosatetraenoate

Molecular Formula: C20H32O3


InChI: InChI=1/C20H32O3/c1-2-3-13-16-19(21)17-14-11-9-7-5-4-6-8-10-12-15-18-20(22)23/h4-5,8-11,14,17,19,21H,2-3,6-7,12-13,15-16,18H2,1H3,(H,22,23)/b5-4-,10-8-,11-9-,17-14+/t19-/m0/s1/f/h22H

InChIKey: InChIKey=JSFATNQSLKRBCI-CJQYHZJYDP
SMILES: CCCCC[[email protected]](O)\C=C\C=C/C\C=C/C\C=C/CCCC(O)=O

CAS number 54845-95-3

Names:
    (15S)-15-Hydroxy-5,8,11-cis-13-trans-eicosatetraenoate
    (15S)-15-hydroxy-5,8,11-cis-13-trans-eicosatetraenoate
    (15S)-15-Hydroxy-5,8,11-cis-13-trans-eicosatetraenoate
    (15S)-15-Hydroxy-5,8,11-cis-13-trans-icosatetraenoate
    (15S)-15-hydroxy-5,8,11-cis-13-trans-icosatetraenoate
    (15S)-15-Hydroxy-5,8,11-cis-13-trans-icosatetraenoate
    (5Z,8Z,11Z,13E)-(15S)-15-Hydroxyicosa-5,8,11,13-tetraenoic acid
    (5Z,8Z,11Z,13E,15S)-15-hydroxyicosa-5,8,11,13-tetraenoic acid
    15S-HETE
    15(S)-HETE

Registries:
    PubChem CID 5280724
    Beilstein =2470466
    CAS 54845-95-3 (from NIST)
    ChEBI 15558
    Kegg C04742
    LIPID MAPS LMFA03060001
    PubChem ID 14850504
    PubChem ID 7313