Chloramphenicol 3-acetate


InChI: InChI=1/C13H14Cl2N2O6/c1-7(18)23-6-10(16-13(20)12(14)15)11(19)8-2-4-9(5-3-8)17(21)22/h2-5,10-12,19H,6H2,1H3,(H,16,20)/t10-,11-/m1/s1

InChIKey: InChIKey=VVOIFRARHIZCJD-GHMZBOCLBR
SMILES: CC(=O)OC[[email protected]@H](NC(=O)C(Cl)Cl)[[email protected]](O)C1=CC=C(C=C1)[N+]([O-])=O

Names:
    Chloramphenicol 3-acetate
    chloramphenicol 3-acetate
    Chloramphenicol 3-acetate
    chloramphenicol 3-acetate

Registries:
    PubChem CID 440060
    ChEBI 16730
    Kegg C03601
    PubChem ID 6392