d-6-Hydroxynicotine


InChI: InChI=1/C10H14N2O/c1-12-6-2-3-9(12)8-4-5-10(13)11-7-8/h4-5,7,9H,2-3,6H2,1H3,(H,11,13)/t9-/m1/s1

InChIKey: InChIKey=ATRCOGLZUCICIV-SECBINFHBN
SMILES: CN1CCC[[email protected]@H]1C2=CC=C(O)N=C2

Names:
    d-6-Hydroxynicotine
    (R)-5-(1-methyl-pyrrolidin-2-yl)-pyridin-2-ol
    (R)-5-(1-methyl-pyrrolidin-2-yl)-1H-pyridin-2-one
    (R)-6-Hydroxynicotine
    (R)-6-hydroxynicotine

Registries:
    PubChem CID 439886
    ChEBI 18226
    Kegg C03043
    PubChem ID 5946
    UM-BBD c0470