N-acetyl-L-leucine

Molecular Formula: C8H15NO3


InChI: InChI=1/C8H15NO3/c1-5(2)4-7(8(11)12)9-6(3)10/h5,7H,4H2,1-3H3,(H,9,10)(H,11,12)/t7-/m0/s1/f/h9,11H

InChIKey: InChIKey=WXNXCEHXYPACJF-IQGQFHNIDL
SMILES: CC(C)C[[email protected]](NC(C)=O)C(O)=O

CAS number 1188-21-2

Names:
    acetylleucine
    KBio2_001793
    N-acetylleucine
    N-acetyl-Leu
    N-Acetyl-L-leucine
    N-acetyl-L-leucine
    N-Acetyl-L-leucine
    N-acetyl-L-leucine
    (2S)-2-acetamido-4-methyl-pentanoic acid
    (2S)-2-(acetylamino)-4-methylpentanoic acid

Registries:
    PubChem CID 70912
    Beilstein =1724849
    CAS 1188-21-2 (from NIST)
    ChEBI 17786
    Gmelin 985259
    Kegg C02710
    PubChem ID 11364207
    PubChem ID 5673