Vitamin A acid

[(Science: biochemistry) The aldehyde (retinal) has long been known to be involved in photoreception, but retinoic acid has other roles. There are cytoplasmic retinoic acid binding proteins and retinoic acid response elements that regulate gene transcription. Retinoic acid is thought to be a morphogen in chick limb bud development and in early development of the chick that probably accounts for its potent teratogenic action. Synonym: vitamin A.

Molecular Formula: C₂₀H₂₇O₂^-

InChI: InChI=1/C20H28O2/c1-15(8-6-9-16(2)14-19(21)22)11-12-18-17(3)10-7-13-20(18,4)5/h6,8-9,11-12,14H,7,10,13H2,1-5H3,(H,21,22)/p-1/b9-6+,12-11+,15-8+,16-14+/fC20H27O2/q-1

InChIKey: InChIKey=SHGAZHPCJJPHSC-YMPNVPDSDJ
SMILES: CC1=C(\C=C\C(C)=C\C=C\C(C)=C\C([O-])=O)C(C)(C)CCC1

Names:
    Acide retinoique (French) (DSL)
    all-trans-Retinoate
    CHEBI:35291
    Retinoate
    retinoate
    Retinoate
    retinoate
    Retinoic acid
    Tretinoine (French) (EINECS)
    Vitamin A acid
    (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraenoate
    (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-1-cyclohexenyl)nona-2,4,6,8-tetraenoate
    3,7-Dimethyl-9-(2,6,6-trimethyl-1-cyclohexene-1-yl)-2,4,6,8-

Registries:
    PubChem CID 6419707
    ChEBI 35291
    Kegg C00777
    PubChem ID 10318857
    PubChem ID 4038