JoCBHF\xABABSJkrnUG[[email protected]

Molecular Formula: C10H7NO2S2


InChI: InChI=1/C10H7NO2S2/c12-7-3-1-6(2-4-7)5-8-9(13)11-10(14)15-8/h1-5,12H,(H,11,13,14)/b8-5-/f/h11H

InChIKey: InChIKey=RAYIDZVPIAJJPF-QSSVCZOFDO
SMILES: C1=CC(=CC=C1C=C2C(=O)NC(=S)S2)O

Names:
    JoCBHF\xABABSJkrnUG[[email protected]
    (5Z)-5-[(4-hydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one

Registries:
    PubChem CID 1241131
    PubChem ID 3252882