Dddd-PGD2

Molecular Formula: C20H30O4


InChI: InChI=1/C20H30O4/c1-2-3-6-10-17(21)13-14-18-16(12-15-19(18)22)9-7-4-5-8-11-20(23)24/h4,7,12,14-17,21H,2-3,5-6,8-11,13H2,1H3,(H,23,24)/b7-4-,18-14+/t16-,17-/m0/s1/f/h23H

InChIKey: InChIKey=TUXFWOHFPFBNEJ-VVBKFOBYDV
SMILES: CCCCC[[email protected]](O)C\C=C1/[[email protected]@H](C\C=C/CCCC(O)=O)C=CC1=O

CAS number 87893-54-7

Names:
    CHEBI:28130
    Dddd-PGD2
    delta(12)-PGJ2
    delta-12-PGJ2
    delta-12-Prostaglandin J2
    δ-12-PGJ2
    (Z)-7-[(1S,5E)-5-[(3S)-3-hydroxyoctylidene]-4-oxo-1-cyclopent-2-enyl]hept-5-enoic acid
    13,14-dihydro-Delta(12)-prostaglandin J2
    87893-54-7
    9-Deoxy-delta(9), delta(12)-13,14-dihydroprostaglandin D2
    9-Deoxy-delta(9,12)-13,14-dihydro PGD2
    9-Deoxy-9,10-didehydro-12,13-didehydro-13,14-dihydroprostaglandin D2

Registries:
    PubChem CID 5280885
    CAS 87893-54-7 (from NIST)
    ChEBI 28130
    Kegg C05958
    LIPID MAPS LMFA03010020
    PubChem ID 14717669
    PubChem ID 8242