S-methyl-L-methionine


InChI: InChI=1/C6H13NO2S/c1-10(2)4-3-5(7)6(8)9/h5H,3-4,7H2,1-2H3/p+1/t5-/m0/s1

InChIKey: InChIKey=YDBYJHTYSHBBAU-YJIVXYNWBY
SMILES: C[S+](C)CC[[email protected]](N)C(O)=O

Names:
    S-Methyl-L-methionine
    S-methyl-L-methionine
    S-Methyl-L-methionine
    S-methyl-L-methionine

Registries:
    PubChem CID 145692
    ChEBI 17728
    Kegg C03172
    PubChem ID 6054