Lindane


InChI: InChI=1/C6H6Cl6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-6H/t1-,2-,3-,4+,5+,6+

InChIKey: InChIKey=JLYXXMFPNIAWKQ-GNIYUCBRBU
SMILES: Cl[[email protected]]1[[email protected]@H](Cl)[[email protected]](Cl)[[email protected]@H](Cl)[[email protected]@H](Cl)[[email protected]@H]1Cl

CAS number 58-89-9

Names:
    Benzene hexachloride
    gamma-Hexachlorocyclohexane
    gamma-hexachlorocyclohexane
    Lindane
    γ-benzene hexachloride
    γ-BHC
    γ-HCH
    γ-lindane
    γ-1,2,3,4,5,6-hexachlorocyclohexane
    (1r,2c,3t,4c,5c,6t)-1,2,3,4,5,6-hexachlorocyclohexane
    (1α,2α,3β,4α,5α,6β)-1,2,3,4,5,6-hexachlorocyclohexane
    1,2,3,4,5,6-Hexachlorocyclohexane

Registries:
    PubChem CID 727
    Beilstein =1907337
    CAS 58-89-9 (from NIST)
    ChEBI 32888
    Kegg C06595
    Kegg C07075
    PubChem ID 8821
    UM-BBD c0141