(S)-α-methylbenzenemethanol

Molecular Formula: C8H10O


InChI: InChI=1/C8H10O/c1-7(9)8-5-3-2-4-6-8/h2-7,9H,1H3/t7-/m0/s1

InChIKey: InChIKey=WAPNOHKVXSQRPX-ZETCQYMHBR
SMILES: C[[email protected]](O)c1ccccc1

CAS number 1445-91-6

Names:
    (S)-α-methylbenzenemethanol
    (S)-1-Phenethyl alcohol
    (S)-1-Phenylethanol
    (S)-1-phenylethanol
    (S)-1-Phenylethanol
    (S)-1-phenylethanol
    (1S)-1-phenylethanol

Registries:
    PubChem CID 443135
    Beilstein =2039797
    CAS 1445-91-6 (from NIST)
    ChEBI 16346
    Gmelin 26803
    Kegg C11348
    PubChem ID 10299210
    PubChem ID 13523
    UM-BBD c0266