D-tagaturonate


InChI: InChI=1/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h3-5,7,9-11H,1H2,(H,12,13)/p-1/t3-,4-,5+/m1/s1

InChIKey: InChIKey=IZSRJDGCGRAUAR-DMOFNURIBI
SMILES: [H][[email protected]@](O)(C([O-])=O)[[email protected]]([H])(O)[[email protected]]([H])(O)C(=O)CO

Names:
    D-Tagaturonate
    D-tagaturonate
    D-Tagaturonate
    D-tagaturonate

Registries:
    PubChem CID 439264
    ChEBI 17886
    Kegg C00558
    PubChem ID 3838