L-norvaline


InChI: InChI=1/C5H11NO2/c1-2-3-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1

InChIKey: InChIKey=SNDPXSYFESPGGJ-BYPYZUCNBD
SMILES: CCC[[email protected]](N)C(O)=O

Names:
    L-Norvaline
    L-norvaline
    L-2-Aminopentanoic acid
    L-2-aminopentanoic acid
    L-2-Aminopentanoic acid
    L-2-aminopentanoic acid
    L-2-Aminovaleric acid
    L-2-aminovaleric acid
    L-2-Aminovaleric acid
    (S)-2-Aminopentanoic acid

Registries:
    PubChem CID 65098
    ChEBI 18314
    Kegg C01826
    PubChem ID 4949