beta-Primeverose

Molecular Formula: C13H24O8


InChI: InChI=1/C13H24O8/c14-6-1-2-8(12(19)10(6)17)21-4-5-3-7(15)11(18)13(20)9(5)16/h5-20H,1-4H2/t5-,6-,7-,8-,9-,10+,11+,12+,13+/m1/s1

InChIKey: InChIKey=IKCGZZFENGHTAJ-BHHYMUIVBX
SMILES: O[[email protected]@H]1CC[[email protected]@H](OC[[email protected]]2C[[email protected]@H](O)[[email protected]](O)[[email protected]@H](O)[[email protected]@H]2O)[[email protected]](O)[[email protected]]1O

Names:
    beta-D-xylopyranosyl-(1->6)-beta-D-glucopyranose
    beta-Primeverose
    CHEBI:16405
    (1R,2S,3S,4R,5R)-5-[[(1R,2R,3S,4R)-2,3,4-trihydroxycyclohexyl]oxymethyl]cyclohexane-1,2,3,4-tetrol
    6-O-(beta-D-Xylopyranosyl)-beta-D-glucopyranose
    6-O-(beta-D-xylopyranosyl)-beta-D-glucopyranose
    6-O-(β-D-xylopyranosyl)-β-D-glucopyranose

Registries:
    PubChem CID 5460077
    ChEBI 16405
    Kegg C11535
    PubChem ID 13702
    PubChem ID 8144682