4'-O-beta-D-glucosyl-cis-p-coumaric acid


InChI: InChI=1/C15H18O8/c16-7-10-12(19)13(20)14(21)15(23-10)22-9-4-1-8(2-5-9)3-6-11(17)18/h1-6,10,12-16,19-21H,7H2,(H,17,18)/b6-3-/t10?,12-,13?,14?,15-/m1/s1

InChIKey: InChIKey=LJFYQZQUAULRDF-DVRWGJPBBE
SMILES: [H][[email protected]]1(O)[[email protected]]([H])(O)C([H])(CO)O[[email protected]@]([H])(OC2=CC=C(\C=C/C(O)=O)C=C2)C1([H])O

Names:
    4'-O-beta-D-Glucosyl-cis-p-coumarate
    4'-O-beta-D-glucosyl-cis-p-coumaric acid
    4'-O-beta-D-glucosyl-cis-4-coumarate
    4'-O-β-D-glucosyl-cis-p-coumarate

Registries:
    PubChem CID 441161
    ChEBI 16099
    Kegg C06739
    PubChem ID 8961