16(R)-HETE

Molecular Formula: C20H32O3


InChI: InChI=1/C20H32O3/c1-2-3-16-19(21)17-14-12-10-8-6-4-5-7-9-11-13-15-18-20(22)23/h4-5,8-11,14,17,19,21H,2-3,6-7,12-13,15-16,18H2,1H3,(H,22,23)/b5-4-,10-8-,11-9-,17-14-/t19-/m1/s1/f/h22H

InChIKey: InChIKey=JEKNPVYFNMZRJG-JZSFBIPJDD
SMILES: CCCC[[email protected]@H](O)\C=C/C\C=C/C\C=C/C\C=C/CCCC(O)=O

Names:
    CHEBI:34162
    (5Z,8Z,11Z,14Z)-(16R)-16-Hydroxyeicosa-5,8,11,14-tetraenoic acid
    (5Z,8Z,11Z,14Z)-(16R)-16-Hydroxyicosa-5,8,11,14-tetraenoic acid
    (5Z,8Z,11Z,14Z,16R)-16-hydroxyicosa-5,8,11,14-tetraenoic acid
    16(R)-HETE

Registries:
    PubChem CID 9548884
    ChEBI 34162
    Kegg C14778
    PubChem ID 14718415