(NZ)-N-(6,7-dihydro-5H-benzofuran-4-ylidene)hydroxylamine

Molecular Formula: C8H9NO2


InChI: InChI=1/C8H9NO2/c10-9-7-2-1-3-8-6(7)4-5-11-8/h4-5,10H,1-3H2/b9-7-

InChIKey: InChIKey=XLJSELFTFQSTNL-CLFYSBASBV
SMILES: C1CC2=C(C=CO2)C(=NO)C1

Names:
    [email protected]^|kiiffjAGH
    (NZ)-N-(6,7-dihydro-5H-benzofuran-4-ylidene)hydroxylamine

Registries:
    PubChem CID 6537039
    PubChem ID 3284956